* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Boc-DL-aspartic acid |
CAS: | 120341-32-4 |
English Synonyms: | BOC-DL-ASPARTIC ACID |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(OC(C)(C)C)NC(CC(=O)O)C(=O)O |
InChi: | InChI=1S/C9H15NO6/c1-9(2,3)16-8(15)10-5(7(13)14)4-6(11)12/h5H,4H2,1-3H3,(H,10,15)(H,11,12)(H,13,14) |
InChiKey: | InChIKey=KAJBMCZQVSQJDE-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.