* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RU 39411 |
CAS: | 120382-04-9 |
English Synonyms: | RU 39411 |
MDL Number.: | MFCD02752468 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C[C@]12C[C@@H]([C@@H]3c4ccc(cc4CC[C@H]3[C@@H]1CC[C@@H]2O)O)c5ccc(cc5)OCCN(C)C |
InChi: | InChI=1S/C28H37NO3/c1-28-17-24(18-4-8-21(9-5-18)32-15-14-29(2)3)27-22-11-7-20(30)16-19(22)6-10-23(27)25(28)12-13-26(28)31/h4-5,7-9,11,16,23-27,30-31H,6,10,12-15,17H2,1-3H3/t23-,24+,25-,26-,27+,28-/m0/s1 |
InChiKey: | InChIKey=VBPPJMXMMHJPDP-JZFZMOLRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.