* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-CHLORO-3-METHYL-1H-PYRAZOLO[4,3-C]PYRIDINE |
| CAS: | 120422-93-7 |
| English Synonyms: | 4-CHLORO-3-METHYL-1H-PYRAZOLO[4,3-C]PYRIDINE ; ABBYPHARMA AP-30-6669 |
| MDL Number.: | MFCD16877659 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1c2c(ccnc2Cl)[nH]n1 |
| InChi: | InChI=1S/C7H6ClN3/c1-4-6-5(11-10-4)2-3-9-7(6)8/h2-3H,1H3,(H,10,11) |
| InChiKey: | InChIKey=KDNYASYYYCLBOA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.