* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-AMINO-3-ETHYL-4-HYDROXY-1H-[1,8]NAPHTHYRIDIN-2-ONE |
| CAS: | 120537-85-1 |
| English Synonyms: | 7-AMINO-3-ETHYL-4-HYDROXY-1H-[1,8]NAPHTHYRIDIN-2-ONE |
| MDL Number.: | MFCD01314302 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | CCc1c(c2ccc(nc2[nH]c1=O)N)O |
| InChi: | InChI=1S/C10H11N3O2/c1-2-5-8(14)6-3-4-7(11)12-9(6)13-10(5)15/h3-4H,2H2,1H3,(H4,11,12,13,14,15) |
| InChiKey: | InChIKey=IMMPFAWYULHKHD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.