* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-IODO-1H-INDAZOL-5-AMINE |
| CAS: | 1208228-61-8 |
| English Synonyms: | 7-IODO-1H-INDAZOL-5-AMINE ; INDAZOL-5-AMINE, 7-IODO- |
| MDL Number.: | MFCD17010096 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1c(cc(c2c1cn[nH]2)I)N |
| InChi: | InChI=1S/C7H6IN3/c8-6-2-5(9)1-4-3-10-11-7(4)6/h1-3H,9H2,(H,10,11) |
| InChiKey: | InChIKey=LYNPOLMEBZDGIU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.