* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | LINOTROBAN |
CAS: | 120824-08-0 |
English Synonyms: | LINOTROBAN |
MDL Number.: | MFCD00866171 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)S(=O)(=O)NCCc2ccc(s2)OCC(=O)O |
InChi: | InChI=1S/C14H15NO5S2/c16-13(17)10-20-14-7-6-11(21-14)8-9-15-22(18,19)12-4-2-1-3-5-12/h1-7,15H,8-10H2,(H,16,17) |
InChiKey: | InChIKey=ISSKMEQROMFEHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.