* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3,5-DISULFOBENZOIC ACID |
CAS: | 121-48-2 |
English Synonyms: | 3,5-DISULFOBENZOIC ACID |
MDL Number.: | MFCD00035757 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | c1c(cc(cc1S(=O)(=O)O)S(=O)(=O)O)C(=O)O |
InChi: | InChI=1S/C7H6O8S2/c8-7(9)4-1-5(16(10,11)12)3-6(2-4)17(13,14)15/h1-3H,(H,8,9)(H,10,11,12)(H,13,14,15) |
InChiKey: | InChIKey=LZRAAMHXKXNHEF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.