* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-IODO-2-(METHYLSULFANYL)PYRAZOLO[1,5-A][1,3,5]TRIAZINE |
| CAS: | 1211114-67-8 |
| English Synonyms: | 8-IODO-2-(METHYLSULFANYL)PYRAZOLO[1,5-A][1,3,5]TRIAZINE |
| MDL Number.: | MFCD18073966 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CSc1ncn2c(n1)c(cn2)I |
| InChi: | InChI=1S/C6H5IN4S/c1-12-6-8-3-11-5(10-6)4(7)2-9-11/h2-3H,1H3 |
| InChiKey: | InChIKey=JMHSJSXGASQFHP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.