* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-CHLORO-1H-INDAZOL-4-AMINE |
| CAS: | 1211527-21-7 |
| English Synonyms: | INDAZOL-4-AMINE, 7-CHLORO- ; 7-CHLORO-1H-INDAZOL-4-AMINE |
| MDL Number.: | MFCD17010085 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc(c2c(c1N)cn[nH]2)Cl |
| InChi: | InChI=1S/C7H6ClN3/c8-5-1-2-6(9)4-3-10-11-7(4)5/h1-3H,9H2,(H,10,11) |
| InChiKey: | InChIKey=VIOIOZHPRWRJGG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.