Molecular Structure:
CAS No.:
121431-71-8
Product Name.:
CCD No.:CCD00239414
Formula:C10 H12 N2 O S
MolWeight:208.284
![THIENO[3,4-B]QUINOXALINE, 1,3,3A,4,9,9A-HEXAHYDRO-, 2-OXIDE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | THIENO[3,4-B]QUINOXALINE, 1,3,3A,4,9,9A-HEXAHYDRO-, 2-OXIDE |
| CAS： | 121431-71-8 |
| English Synonyms： | THIENO[3,4-B]QUINOXALINE, 1,3,3A,4,9,9A-HEXAHYDRO-, 2-OXIDE |
| MDL Number.： | MFCD01680465 |
| H bond acceptor： | 3 |
| H bond donor： | 2 |
| Smile： | c1ccc2c(c1)NC3CS(=O)CC3N2 |
| InChi： | InChI=1S/C10H12N2OS/c13-14-5-9-10(6-14)12-8-4-2-1-3-7(8)11-9/h1-4,9-12H,5-6H2 |
| InChiKey： | InChIKey=CVKQQGHRARURPG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
