* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (2S,3R)-2-AMINO-3-METHYLSUCCINIC ACID |
CAS: | 121570-10-3 |
English Synonyms: | (2S,3R)-2-AMINO-3-METHYLSUCCINIC ACID |
MDL Number.: | MFCD13195543 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | C[C@H]([C@@H](C(=O)O)N)C(=O)O |
InChi: | InChI=1S/C5H9NO4/c1-2(4(7)8)3(6)5(9)10/h2-3H,6H2,1H3,(H,7,8)(H,9,10)/t2-,3+/m1/s1 |
InChiKey: | InChIKey=LXRUAYBIUSUULX-GBXIJSLDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.