* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzenebutanol, 3,4-difluoro- |
CAS: | 1215948-69-8 |
English Synonyms: | BENZENEBUTANOL, 3,4-DIFLUORO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC=1C=C(C=CC1F)CCCCO |
InChi: | InChI=1S/C10H12F2O/c11-9-5-4-8(7-10(9)12)3-1-2-6-13/h4-5,7,13H,1-3,6H2 |
InChiKey: | InChIKey=MXMJIPKASSHIQK-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.