* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-(1,3-DIOXAN-2-YL)-4'-METHOXYPROPIOPHENONE |
CAS: | 121789-38-6 |
English Synonyms: | 3-(1,3-DIOXAN-2-YL)-4'-METHOXYPROPIOPHENONE |
MDL Number.: | MFCD02261805 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | COc1ccc(cc1)C(=O)CCC2OCCCO2 |
InChi: | InChI=1S/C14H18O4/c1-16-12-5-3-11(4-6-12)13(15)7-8-14-17-9-2-10-18-14/h3-6,14H,2,7-10H2,1H3 |
InChiKey: | InChIKey=IDEMILWOCUWVGQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.