* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(benzyloxy)-1,3-dibromobenzene |
CAS: | 122110-76-3 |
English Synonyms: | 2-(BENZYLOXY)-1,3-DIBROMOBENZENE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C1=CC=CC=C1)OC1=C(C=CC=C1Br)Br |
InChi: | InChI=1S/C13H10Br2O/c14-11-7-4-8-12(15)13(11)16-9-10-5-2-1-3-6-10/h1-8H,9H2 |
InChiKey: | InChIKey=FYTQDADUVFGKHG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.