* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-(1-BUTENYL)-1,2-BENZENEDIOL |
CAS: | 122207-61-8 |
English Synonyms: | 4-BUT-1-ENYL-1,2-DIHYDROXY BENZENE ; 4-(1-BUTENYL)-1,2-BENZENEDIOL ; 4-[(1E)-BUT-1-EN-1-YL]BENZENE-1,2-DIOL |
MDL Number.: | MFCD16875971 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CC/C=C/c1ccc(c(c1)O)O |
InChi: | InChI=1S/C10H12O2/c1-2-3-4-8-5-6-9(11)10(12)7-8/h3-7,11-12H,2H2,1H3/b4-3+ |
InChiKey: | InChIKey=NKQXNJLAMGMXAM-ONEGZZNKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.