* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-CHLORO-5-IODOINDOLE |
| CAS: | 122509-74-4 |
| English Synonyms: | 6-CHLORO-5-IODO-1H-INDOLE ; 6-CHLORO-5-IODOINDOLE |
| MDL Number.: | MFCD16875986 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1c[nH]c2c1cc(c(c2)Cl)I |
| InChi: | InChI=1S/C8H5ClIN/c9-6-4-8-5(1-2-11-8)3-7(6)10/h1-4,11H |
| InChiKey: | InChIKey=KHJBSNUBUOHZAG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.