* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Pentanamine, 5-(2-methylphenoxy)- |
CAS: | 1226193-29-8 |
English Synonyms: | 1-PENTANAMINE, 5-(2-METHYLPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1=C(OCCCCCN)C=CC=C1 |
InChi: | InChI=1S/C12H19NO/c1-11-7-3-4-8-12(11)14-10-6-2-5-9-13/h3-4,7-8H,2,5-6,9-10,13H2,1H3 |
InChiKey: | InChIKey=ICMLOUSWYNPOBA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.