* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-IODO-1H-PYRROLO[2,3-C]PYRIDINE |
CAS: | 1227270-26-9 |
English Synonyms: | 2-IODO-1H-PYRROLO[2,3-C]PYRIDINE ; 2-IODO-6-AZAINDOLE |
MDL Number.: | MFCD16875891 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cncc2c1cc([nH]2)I |
InChi: | InChI=1S/C7H5IN2/c8-7-3-5-1-2-9-4-6(5)10-7/h1-4,10H |
InChiKey: | InChIKey=WSBRJCFHGLRDAF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.