* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(BROMOMETHYL)-3-IODO-1H-INDAZOLE |
CAS: | 1228880-67-8 |
English Synonyms: | 5-(BROMOMETHYL)-3-IODO-1H-INDAZOLE |
MDL Number.: | MFCD16877250 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc2c(cc1CBr)c(n[nH]2)I |
InChi: | InChI=1S/C8H6BrIN2/c9-4-5-1-2-7-6(3-5)8(10)12-11-7/h1-3H,4H2,(H,11,12) |
InChiKey: | InChIKey=KCQJCQMLEWRRNO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.