* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FAERIEFUNGIN B |
CAS: | 123166-68-7 |
English Synonyms: | FAERIEFUNGIN B |
MDL Number.: | MFCD00877053 |
H bond acceptor: | 10 |
H bond donor: | 8 |
Smile: | CCC(C)C1C(/C=C/C(CC(CC(CC(CC(CC(CC(C(C(C/C=C/C=C/C=C/C=C/C=C/C(=O)O1)O)C)O)O)O)O)O)O)O)C |
InChi: | InChI=1S/C37H60O10/c1-5-25(2)37-26(3)17-18-28(38)19-29(39)20-30(40)21-31(41)22-32(42)23-33(43)24-35(45)27(4)34(44)15-13-11-9-7-6-8-10-12-14-16-36(46)47-37/h6-14,16-18,25-35,37-45H,5,15,19-24H2,1-4H3/b8-6+,9-7+,12-10+,13-11+,16-14+,18-17+ |
InChiKey: | InChIKey=JJEXXRLQYFLSMX-LREHYBSCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.