* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Pyrrolidineacetic acid, α-methyl-, (αR)- |
CAS: | 1234836-32-8 |
English Synonyms: | 1-PYRROLIDINEACETIC ACID, Α-METHYL-, (ΑR)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C[C@H](C(=O)O)N1CCCC1 |
InChi: | InChI=1S/C7H13NO2/c1-6(7(9)10)8-4-2-3-5-8/h6H,2-5H2,1H3,(H,9,10)/t6-/m1/s1 |
InChiKey: | InChIKey=HAEBOIOLDSOIGG-ZCFIWIBFSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.