* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-amino-7-cyclobutyl-5-iodo-Imidazo[5,1-f][1,2,4]triazin-4(1H)-one |
CAS: | 1236162-34-7 |
English Synonyms: | 2-AMINO-7-CYCLOBUTYL-5-IODO-IMIDAZO[5,1-F][1,2,4]TRIAZIN-4(1H)-ONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NC=1NN2C(C(N1)=O)=C(N=C2C2CCC2)I |
InChi: | InChI=1S/C9H10IN5O/c10-6-5-8(16)13-9(11)14-15(5)7(12-6)4-2-1-3-4/h4H,1-3H2,(H3,11,13,14,16) |
InChiKey: | InChIKey=KOZDQPREMMWOBN-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.