* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 9,9-DI-N-OCTYLFLUORENE |
CAS: | 123863-99-0 |
English Synonyms: | 9,9-DI-N-OCTYLFLUORENE |
MDL Number.: | MFCD08276358 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CCCCCCCCC1(c2ccccc2-c3c1cccc3)CCCCCCCC |
InChi: | InChI=1S/C29H42/c1-3-5-7-9-11-17-23-29(24-18-12-10-8-6-4-2)27-21-15-13-19-25(27)26-20-14-16-22-28(26)29/h13-16,19-22H,3-12,17-18,23-24H2,1-2H3 |
InChiKey: | InChIKey=RXACYPFGPNTUNV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.