* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-[3-(2-METHOXY-ETHYL)-[1,2,4]OXADIAZOL-5-YL]-1H-INDOLE |
CAS: | 1239754-89-2 |
English Synonyms: | 5-(1H-INDOL-2-YL)-3-(2-METHOXYETHYL)-1,2,4-OXADIAZOLE ; 2-[3-(2-METHOXY-ETHYL)-[1,2,4]OXADIAZOL-5-YL]-1H-INDOLE |
MDL Number.: | MFCD16874961 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | COCCc1nc(on1)c2cc3ccccc3[nH]2 |
InChi: | InChI=1S/C13H13N3O2/c1-17-7-6-12-15-13(18-16-12)11-8-9-4-2-3-5-10(9)14-11/h2-5,8,14H,6-7H2,1H3 |
InChiKey: | InChIKey=GYJRFRUSCKPOIZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.