* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-PRO-LEU-ALA-NHOH |
CAS: | 123984-00-9 |
English Synonyms: | Z-PRO-LEU-ALA-NHOH |
MDL Number.: | MFCD00238505 |
H bond acceptor: | 10 |
H bond donor: | 4 |
Smile: | CC(C)C[C@@H](C(=O)N[C@@H](C)C(=O)NO)NC(=O)[C@@H]1CCCN1C(=O)OCc2ccccc2 |
InChi: | InChI=1S/C22H32N4O6/c1-14(2)12-17(20(28)23-15(3)19(27)25-31)24-21(29)18-10-7-11-26(18)22(30)32-13-16-8-5-4-6-9-16/h4-6,8-9,14-15,17-18,31H,7,10-13H2,1-3H3,(H,23,28)(H,24,29)(H,25,27)/t15-,17-,18-/m0/s1 |
InChiKey: | InChIKey=FAGYGQYGBIUTAJ-SZMVWBNQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.