* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(3-CHLOROMETHYL-[1,2,4]OXADIAZOL-5-YL)-1H-INDOLE |
CAS: | 1239847-74-5 |
English Synonyms: | 3-(CHLOROMETHYL)-5-(1H-INDOL-2-YL)-1,2,4-OXADIAZOLE ; 2-(3-CHLOROMETHYL-[1,2,4]OXADIAZOL-5-YL)-1H-INDOLE |
MDL Number.: | MFCD16875370 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)cc([nH]2)c3nc(no3)CCl |
InChi: | InChI=1S/C11H8ClN3O/c12-6-10-14-11(16-15-10)9-5-7-3-1-2-4-8(7)13-9/h1-5,13H,6H2 |
InChiKey: | InChIKey=QPNMPYPMKOLSJJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.