* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SCILLAREN A |
| CAS: | 124-99-2 |
| English Synonyms: | SCILLAREN A |
| MDL Number.: | MFCD00869441 |
| H bond acceptor: | 13 |
| H bond donor: | 7 |
| Smile: | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@H]2CC[C@@]3([C@H]4CC[C@@]5([C@H](CC[C@@]5([C@@H]4CCC3=C2)O)c6ccc(=O)oc6)C)C)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O |
| InChi: | InChI=1S/C36H52O13/c1-17-31(49-33-29(42)27(40)26(39)24(15-37)48-33)28(41)30(43)32(46-17)47-20-8-11-34(2)19(14-20)5-6-23-22(34)9-12-35(3)21(10-13-36(23,35)44)18-4-7-25(38)45-16-18/h4,7,14,16-17,20-24,26-33,37,39-44H,5-6,8-13,15H2,1-3H3/t17-,20-,21+,22-,23+,24+,26+,27-,28-,29+,30+,31-,32-,33-,34-,35+,36-/m0/s1 |
| InChiKey: | InChIKey=NXJOCELNFPGKIV-ARHXXGKOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.