* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-BROMO-5-METHYLOXAZOLE |
CAS: | 1240601-01-7 |
English Synonyms: | 4-BROMO-5-METHYL-1,3-OXAZOLE ; 4-BROMO-5-METHYLOXAZOLE |
MDL Number.: | MFCD16989293 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | Cc1c(nco1)Br |
InChi: | InChI=1S/C4H4BrNO/c1-3-4(5)6-2-7-3/h2H,1H3 |
InChiKey: | InChIKey=MDCZFTAWFJRCII-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.