* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-BROMOOXAZOL-4-OL |
CAS: | 1240609-00-0 |
English Synonyms: | 2-BROMOOXAZOL-4-OL |
MDL Number.: | MFCD16989418 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1c(nc(o1)Br)O |
InChi: | InChI=1S/C3H2BrNO2/c4-3-5-2(6)1-7-3/h1,6H |
InChiKey: | InChIKey=UETIDMTWCSOGBT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.