* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (4-AMINOOXAZOL-2-YL)METHANOL |
CAS: | 1240614-62-3 |
English Synonyms: | (4-AMINOOXAZOL-2-YL)METHANOL |
MDL Number.: | MFCD16989377 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1c(nc(o1)CO)N |
InChi: | InChI=1S/C4H6N2O2/c5-3-2-8-4(1-7)6-3/h2,7H,1,5H2 |
InChiKey: | InChIKey=LJYYPZNKGIQISH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.