* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | D-Tyrosine, O-(2,4-dinitrophenyl)- |
CAS: | 1241676-01-6 |
English Synonyms: | D-TYROSINE, O-(2,4-DINITROPHENYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | [N+](=O)([O-])C1=C(C=CC(=C1)[N+](=O)[O-])OC1=CC=C(C[C@@H](N)C(=O)O)C=C1 |
InChi: | InChI=1S/C15H13N3O7/c16-12(15(19)20)7-9-1-4-11(5-2-9)25-14-6-3-10(17(21)22)8-13(14)18(23)24/h1-6,8,12H,7,16H2,(H,19,20)/t12-/m1/s1 |
InChiKey: | InChIKey=OHFDOVYRFJQGIR-GFCCVEGCSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.