* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzenepentanoic acid, δ-amino-, (δS)- |
CAS: | 1241679-15-1 |
English Synonyms: | BENZENEPENTANOIC ACID, Δ-AMINO-, (ΔS)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N[C@@H](CCCC(=O)O)C1=CC=CC=C1 |
InChi: | InChI=1S/C11H15NO2/c12-10(7-4-8-11(13)14)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8,12H2,(H,13,14)/t10-/m0/s1 |
InChiKey: | InChIKey=ZJNFPTDVGIVNDW-JTQLQIEISA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.