* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-BENZYL-2,7-DIAZASPIRO[4.5]DECAN-1-ONE |
| CAS: | 1245643-65-5 |
| English Synonyms: | 7-BENZYL-2,7-DIAZASPIRO[4.5]DECAN-1-ONE |
| MDL Number.: | MFCD17011735 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1ccc(cc1)CN2CCCC3(C2)CCNC3=O |
| InChi: | InChI=1S/C15H20N2O/c18-14-15(8-9-16-14)7-4-10-17(12-15)11-13-5-2-1-3-6-13/h1-3,5-6H,4,7-12H2,(H,16,18) |
| InChiKey: | InChIKey=RUXGTEQSWKODCG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.