* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1H-INDOLE, 2-(3-FLUOROPHENYL)- |
CAS: | 124643-63-6 |
English Synonyms: | 1H-INDOLE, 2-(3-FLUOROPHENYL)- ; 2-(3-FLUOROPHENYL)-1H-INDOLE |
MDL Number.: | MFCD02948488 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)cc([nH]2)c3cccc(c3)F |
InChi: | InChI=1S/C14H10FN/c15-12-6-3-5-10(8-12)14-9-11-4-1-2-7-13(11)16-14/h1-9,16H |
InChiKey: | InChIKey=RZUCLPBTUPSEME-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.