* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-Pentanamine, 4-methyl-1-(methylthio)- |
CAS: | 1247496-39-4 |
English Synonyms: | 2-PENTANAMINE, 4-METHYL-1-(METHYLTHIO)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(CC(CSC)N)C |
InChi: | InChI=1S/C7H17NS/c1-6(2)4-7(8)5-9-3/h6-7H,4-5,8H2,1-3H3 |
InChiKey: | InChIKey=WBXCUKRXEVONCG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.