* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5-(2-METHOXY-5-METHYLPHENYL)-1,3,4-OXADIAZOL-2-AMINE |
| CAS: | 1248905-09-0 |
| English Synonyms: | 5-(2-METHOXY-5-METHYLPHENYL)-1,3,4-OXADIAZOL-2-AMINE |
| MDL Number.: | MFCD16781008 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(c(c1)c2nnc(o2)N)OC |
| InChi: | InChI=1S/C10H11N3O2/c1-6-3-4-8(14-2)7(5-6)9-12-13-10(11)15-9/h3-5H,1-2H3,(H2,11,13) |
| InChiKey: | InChIKey=MNQMLUVYRUUBCW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.