* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,3'-Bipyrrolidine]-2,5-dione |
CAS: | 1249027-58-4 |
English Synonyms: | [1,3'-BIPYRROLIDINE]-2,5-DIONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N1(C(CCC1=O)=O)C1CNCC1 |
InChi: | InChI=1S/C8H12N2O2/c11-7-1-2-8(12)10(7)6-3-4-9-5-6/h6,9H,1-5H2 |
InChiKey: | InChIKey=LMHMKDMJSPIDQA-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.