* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | β-Alanine, N,N-di-2-propen-1-yl- |
CAS: | 124929-55-1 |
English Synonyms: | Β-ALANINE, N,N-DI-2-PROPEN-1-YL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C=C)N(CCC(=O)O)CC=C |
InChi: | InChI=1S/C9H15NO2/c1-3-6-10(7-4-2)8-5-9(11)12/h3-4H,1-2,5-8H2,(H,11,12) |
InChiKey: | InChIKey=DUUFVJCLNRNOTQ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.