* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OXYPHENCYCLIMINE |
| CAS: | 125-53-1 ;125-52-0 |
| English Synonyms: | OXYPHENCYCLIMINE |
| MDL Number.: | MFCD00865159 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CN1CCCN=C1COC(=O)C(c2ccccc2)(C3CCCCC3)O |
| InChi: | InChI=1S/C20H28N2O3/c1-22-14-8-13-21-18(22)15-25-19(23)20(24,16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2,4-5,9-10,17,24H,3,6-8,11-15H2,1H3 |
| InChiKey: | InChIKey=DUDKAZCAISNGQN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.