* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1-Pentanol, 5-(2-ethylphenoxy)- |
CAS: | 1250635-22-3 |
English Synonyms: | 1-PENTANOL, 5-(2-ETHYLPHENOXY)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C)C1=C(OCCCCCO)C=CC=C1 |
InChi: | InChI=1S/C13H20O2/c1-2-12-8-4-5-9-13(12)15-11-7-3-6-10-14/h4-5,8-9,14H,2-3,6-7,10-11H2,1H3 |
InChiKey: | InChIKey=DHMQXQURQFRXKV-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.