* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FURAQUINOCIN A |
CAS: | 125108-66-9 |
English Synonyms: | FURAQUINOCIN A |
MDL Number.: | MFCD00891654 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | CC1C(c2c(cc3c(c2O1)C(=O)C(=C(C3=O)OC)C)O)(C)C(C/C=C(/C)\CO)O |
InChi: | InChI=1S/C22H26O7/c1-10(9-23)6-7-15(25)22(4)12(3)29-21-16-13(8-14(24)17(21)22)19(27)20(28-5)11(2)18(16)26/h6,8,12,15,23-25H,7,9H2,1-5H3/b10-6- |
InChiKey: | InChIKey=FBOIBFWCHWNBOE-POHAHGRESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.