* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6,6-DIFLUORO-3-AZABICYCLO[3.1.1]HEPTANE |
CAS: | 1251923-21-3 |
English Synonyms: | 6,6-DIFLUORO-3-AZABICYCLO[3.1.1]HEPTANE |
MDL Number.: | MFCD16990750 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C1[C@@H]2CNC[C@H]1C2(F)F |
InChi: | InChI=1S/C6H9F2N/c7-6(8)4-1-5(6)3-9-2-4/h4-5,9H,1-3H2/t4-,5+ |
InChiKey: | InChIKey=OPKGZZULJOUJEV-SYDPRGILSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.