* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-Butanone, 4-(3,4-difluorophenyl)- |
CAS: | 1251925-01-5 |
English Synonyms: | 2-BUTANONE, 4-(3,4-DIFLUOROPHENYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC=1C=C(C=CC1F)CCC(C)=O |
InChi: | InChI=1S/C10H10F2O/c1-7(13)2-3-8-4-5-9(11)10(12)6-8/h4-6H,2-3H2,1H3 |
InChiKey: | InChIKey=ASSREUIIQDCZED-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.