Molecular Structure:
CAS No.:
1253792-66-3
Product Name.:
CCD No.:CCD03283611
Formula:C10 H7 N3 O3 S
MolWeight:249.249
![7-(METHYLTHIO)-1-(PROP-2-YNYL)-1H-PYRIMIDO[4,5-D][1,3]OXAZINE-2,4-DIONE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(9)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(3)
|
|
| Product Name： | 7-(METHYLTHIO)-1-(PROP-2-YNYL)-1H-PYRIMIDO[4,5-D][1,3]OXAZINE-2,4-DIONE |
| CAS： | 1253792-66-3 |
| English Synonyms： | 7-(METHYLTHIO)-1-(PROP-2-YNYL)-1H-PYRIMIDO[4,5-D][1,3]OXAZINE-2,4-DIONE |
| MDL Number.： | MFCD17011935 |
| H bond acceptor： | 6 |
| H bond donor： | 0 |
| Smile： | CSc1ncc2c(n1)n(c(=O)oc2=O)CC#C |
| InChi： | InChI=1S/C10H7N3O3S/c1-3-4-13-7-6(8(14)16-10(13)15)5-11-9(12-7)17-2/h1,5H,4H2,2H3 |
| InChiKey： | InChIKey=BKHWZERISSTGEU-UHFFFAOYSA-N |
|
|
| Comments： | WARNINGS: IRRITANT |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
