* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RO 41-0960 |
| CAS: | 125628-97-9 |
| English Synonyms: | RO 41-0960 ; 2'-FLUORO-3,4-DIHYDROXY-5-NITROBENZOPHENONE |
| MDL Number.: | MFCD00078597 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1ccc(c(c1)C(=O)c2cc(c(c(c2)O)O)[N+](=O)[O-])F |
| InChi: | InChI=1S/C13H8FNO5/c14-9-4-2-1-3-8(9)12(17)7-5-10(15(19)20)13(18)11(16)6-7/h1-6,16,18H |
| InChiKey: | InChIKey=RQPAUNZYTYHKHA-UHFFFAOYSA-N |
|
|
|
|
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.