* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PLEGAROL |
| CAS: | 126-79-4 |
| English Synonyms: | PLEGAROL |
| MDL Number.: | MFCD01687619 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC[N+](C)(CC)CCOCC[N+]1(CCCC1)C.[I-].[I-] |
| InChi: | InChI=1S/C14H32N2O.2HI/c1-5-15(3,6-2)11-13-17-14-12-16(4)9-7-8-10-16;;/h5-14H2,1-4H3;2*1H/q+2;;/p-2 |
| InChiKey: | InChIKey=VACPTJTYMJLQSW-UHFFFAOYSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.