* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Phenylalanine, 2,4,5-trifluoro- |
CAS: | 1260002-73-0 |
English Synonyms: | PHENYLALANINE, 2,4,5-TRIFLUORO- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC1=C(C[C@H](N)C(=O)O)C=C(C(=C1)F)F |
InChi: | InChI=1S/C9H8F3NO2/c10-5-3-7(12)6(11)1-4(5)2-8(13)9(14)15/h1,3,8H,2,13H2,(H,14,15)/t8-/m0/s1 |
InChiKey: | InChIKey=SWJFYJHCOWRRLR-QMMMGPOBSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.