* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-Pyrrolidinamine, N,N-bis(phenylmethyl)-, (3S)- |
CAS: | 1260589-65-8 |
English Synonyms: | 3-PYRROLIDINAMINE, N,N-BIS(PHENYLMETHYL)-, (3S)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(=CC=CC=C1)CN([C@@H]1CNCC1)CC1=CC=CC=C1 |
InChi: | InChI=1S/C18H22N2/c1-3-7-16(8-4-1)14-20(18-11-12-19-13-18)15-17-9-5-2-6-10-17/h1-10,18-19H,11-15H2/t18-/m0/s1 |
InChiKey: | InChIKey=RSBBPYMMUAWQSI-SFHVURJKSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.