* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ICARISIDE E5 |
CAS: | 126176-79-2 |
English Synonyms: | ICARISIDE E5 |
MDL Number.: | MFCD17214940 |
H bond acceptor: | 11 |
H bond donor: | 7 |
Smile: | COc1cc(ccc1O)C[C@@H](CO)c2cc(cc(c2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)OC)/C=C/CO |
InChi: | InChI=1S/C26H34O11/c1-34-19-10-15(5-6-18(19)30)8-16(12-28)17-9-14(4-3-7-27)11-20(35-2)25(17)37-26-24(33)23(32)22(31)21(13-29)36-26/h3-6,9-11,16,21-24,26-33H,7-8,12-13H2,1-2H3/b4-3+/t16-,21+,22+,23-,24+,26-/m0/s1 |
InChiKey: | InChIKey=UFFRBCKYXMEITK-RUBGFCLFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.