* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KT5823 |
| CAS: | 126643-37-6 |
| English Synonyms: | 2,3,9,10,11,12-HEXAHYDRO-10R-METHOXY-2,9-DIMETHYL-1-OXO-9S,12R-EPOXY-1H-DIINDOLO[1,2,3-FG:3',2',1'-KL]PYRROLO[3,4-I][1,6]BENZODIAZOCINE-10-CARBOXYLIC ACID, METHYL ESTER ; KT5823 |
| MDL Number.: | MFCD09878278 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | C[C@@]12[C@](C[C@@H](O1)n3c4ccccc4c5c3c6n2c7ccccc7c6c8c5C(=O)N(C8)C)(C(=O)OC)OC |
| InChi: | InChI=1S/C29H25N3O5/c1-28-29(36-4,27(34)35-3)13-20(37-28)31-18-11-7-5-9-15(18)22-23-17(14-30(2)26(23)33)21-16-10-6-8-12-19(16)32(28)25(21)24(22)31/h5-12,20H,13-14H2,1-4H3/t20-,28+,29+/m1/s1 |
| InChiKey: | InChIKey=QTYMDECKVKSGSM-YMUMJAELSA-N |
|
|
|
|
| WGK Germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.